WCO classification path
- Chapter38Miscellaneous chemical products
- Heading3827Mixtures containing halogenated derivatives of methane, ethane or propane, not elsewhere specified or included
- Subheading382711Containing chlorofluorocarbons(CFCs), whether or not containing hydrochlorofluorocarbons (HCFCs), perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs)
- National38271190Other
38271190
"Other"
HS code 3827119000 (Chapter 38 "Miscellaneous chemical products"; Heading 3827 "Mixtures containing halogenated derivatives of methane, ethane or propane, not elsewhere specified or included"; Subheading 382711 "Containing chlorofluorocarbons(CFCs), whether or not containing hydrochlorofluorocarbons (HCFCs), perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs)") under the Korea tariff schedule classifies "Other". Korea customs apply MFN rate of 8, WTO bound rate 0. Statutory unit of measure: KG. 31 free trade agreement preferential rates are available for this code.
Tariff Schedule
| Classification | Rate |
|---|---|
MFN 税率 MFN rate | 8 |
WTO 约束税率 WTO bound rate | 0 |
FTA Preferential Rates
31 agreements available · certificate of origin required
| Agreement | Rate |
|---|---|
| AKFTA (ASEAN-Korea) | 0% |
| KAFTA (Korea-Australia) | 0% |
| CKFTA (Canada-Korea) / CPTPP | 0% |
| Korea-Central America (Costa Rica) | 0% |
| Korea-Central America (Honduras) | 0% |
| Korea-Central America (Nicaragua) | 0% |
| Korea-Central America (Panama) | 0% |
| Korea-Central America (El Salvador) | 0% |
| Korea-Chile | 0% |
| Korea-China | 0% |
| Korea-Colombia | 0% |
| Korea-EFTA | 0% |
| Korea-EU | 0% |
| Korea-UK | 0% |
| Korea-Indonesia (CEPA) | 0% |
| Korea-Israel | 0% |
| Korea-India (CEPA) | 0% |
| Korea-Cambodia | 0% |
| Korea-New Zealand | 0% |
| Korea-Peru | 0% |
| Korea-Philippines | 0% |
| RCEP (ASEAN) | 0% |
| RCEP (Australia) | 0% |
| RCEP (China) | 0% |
| RCEP (Japan) | 0% |
| RCEP (New Zealand) | 0% |
| Korea-Singapore | 0% |
| Korea-Turkey | 0% |
| KORUS (Korea-US) | 0% |
| Korea-Vietnam | 0% |
| RCEP | 0% |
Global Benchmark
HS-6 prefix 3827.11 across other jurisdictions